CymitQuimica logo

CAS 93618-35-0

:

3-(3-Bromophenyl)-1-methyl-1H-pyrazole-5-carboxylic acid

Description:
3-(3-Bromophenyl)-1-methyl-1H-pyrazole-5-carboxylic acid is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a bromophenyl group at the 3-position of the pyrazole ring contributes to its unique properties, including potential biological activity and reactivity. The carboxylic acid functional group at the 5-position enhances its solubility in polar solvents and can participate in hydrogen bonding, making it useful in various chemical reactions and applications. This compound may exhibit interesting pharmacological properties, making it a subject of research in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, which can be explored for therapeutic purposes. Additionally, the presence of the bromine atom can influence the compound's electronic properties and reactivity, making it a valuable candidate for further studies in organic synthesis and drug development. Overall, this compound exemplifies the diverse chemistry associated with substituted pyrazoles.
Formula:C11H9BrN2O2
InChI:InChI=1S/C11H9BrN2O2/c1-14-10(11(15)16)6-9(13-14)7-3-2-4-8(12)5-7/h2-6H,1H3,(H,15,16)
InChI key:InChIKey=GTQOCIVSRQYCAK-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(=NN1C)C2=CC(Br)=CC=C2
Synonyms:
  • 1H-Pyrazole-5-carboxylic acid, 3-(3-bromophenyl)-1-methyl-
  • 3-(3-Bromophenyl)-1-methyl-1H-pyrazole-5-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.