CAS 93618-98-5
:dibenzo[b,d]thiophen-3-amine 5,5-dioxide
Description:
Dibenzo[b,d]thiophen-3-amine 5,5-dioxide, with the CAS number 93618-98-5, is a heterocyclic organic compound characterized by its unique structure, which includes a dibenzo[b,d]thiophene core and an amine functional group, along with a sulfone (5,5-dioxide) moiety. This compound typically exhibits properties associated with both aromatic and sulfur-containing compounds, such as stability and potential reactivity due to the presence of the amine group. It may be soluble in organic solvents and exhibit moderate polarity. The presence of the sulfone group can enhance its chemical reactivity, making it a candidate for various chemical transformations. Dibenzo[b,d]thiophenes are often studied for their applications in organic electronics, pharmaceuticals, and as intermediates in organic synthesis. The compound's specific characteristics, such as melting point, boiling point, and spectral data, would require experimental determination or reference to specialized databases for precise values. Overall, dibenzo[b,d]thiophen-3-amine 5,5-dioxide represents a versatile structure with potential applications in multiple fields of chemistry.
Formula:C12H9NO2S
InChI:InChI=1/C12H9NO2S/c13-8-5-6-10-9-3-1-2-4-11(9)16(14,15)12(10)7-8/h1-7H,13H2
SMILES:c1ccc2c(c1)c1ccc(cc1S2(=O)=O)N
Synonyms:- dibenzo[b,d]thiophen-3-amine, 5,5-dioxide
- Dibenzo[b,d]thiophen-3-amine 5,5-dioxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.