CAS 93621-94-4
:(2S,5S)-2,5-bis(methoxymethyl)pyrrolidinium
Description:
(2S,5S)-2,5-bis(methoxymethyl)pyrrolidinium, identified by its CAS number 93621-94-4, is a quaternary ammonium compound characterized by its pyrrolidine ring structure, which features two methoxymethyl substituents at the 2 and 5 positions. This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of the quaternary ammonium group, which enhances its ionic character. The stereochemistry indicated by the (2S,5S) configuration suggests specific spatial arrangements of the substituents, which can influence its biological activity and interaction with other molecules. Such compounds are often studied for their potential applications in pharmaceuticals, as they may exhibit antimicrobial or antiviral properties. Additionally, the methoxymethyl groups can provide stability and modulate the lipophilicity of the molecule, affecting its permeability and bioavailability. Overall, (2S,5S)-2,5-bis(methoxymethyl)pyrrolidinium represents a class of compounds with diverse applications in medicinal chemistry and materials science.
Formula:C8H18NO2
InChI:InChI=1/C8H17NO2/c1-10-5-7-3-4-8(9-7)6-11-2/h7-9H,3-6H2,1-2H3/p+1/t7-,8-/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.