CAS 936243-44-6

2-Methyl-1H-pyrrolo[2,3-b]pyridin-3-amine

Description:

2-Methyl-1H-pyrrolo[2,3-b]pyridin-3-amine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features a methyl group at the 2-position of the pyrrole ring and an amino group at the 3-position of the pyridine ring, enhancing its potential for biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as similar structures have been associated with various biological activities, including anti-cancer and anti-inflammatory properties. Additionally, its molecular framework allows for potential interactions with biological targets, making it a subject of interest in drug discovery. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₈H₉N₃

InChI: InChI=1S/C8H9N3/c1-5-7(9)6-3-2-4-10-8(6)11-5/h2-4H,9H2,1H3,(H,10,11)

InChI key: InChIKey=NEHBOXJWQVLSLC-UHFFFAOYSA-N

SMILES: NC=1C=2C(NC1C)=NC=CC2

Synonyms:

• 2-Methyl-1H-pyrrolo[2,3-b]pyridin-3-ylamine
• 2-Methyl-1H-pyrrolo[2,3-b]pyridin-3-amine
• 1H-Pyrrolo[2,3-b]pyridin-3-amine, 2-methyl-