
CAS 936249-46-6
:3-(3-Furanyl)benzenamine
Description:
3-(3-Furanyl)benzenamine, also known by its CAS number 936249-46-6, is an organic compound characterized by the presence of both a furan ring and an aniline moiety. The furan ring, a five-membered aromatic heterocycle containing oxygen, contributes to the compound's reactivity and potential for forming various derivatives. The aniline part of the molecule, which consists of a benzene ring bonded to an amino group, imparts basic properties and can participate in electrophilic substitution reactions. This compound may exhibit interesting biological activities due to the combination of the furan and aniline structures, making it a subject of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary based on the specific conditions and solvents used. Additionally, the presence of functional groups in the molecule can influence its interactions with other chemical species, making it relevant in various synthetic applications and research contexts. Overall, 3-(3-Furanyl)benzenamine represents a versatile scaffold for further chemical exploration and potential applications in pharmaceuticals.
Formula:C10H9NO
InChI:InChI=1S/C10H9NO/c11-10-3-1-2-8(6-10)9-4-5-12-7-9/h1-7H,11H2
InChI key:InChIKey=LQDARHFLRKPAMM-UHFFFAOYSA-N
SMILES:NC=1C=C(C=CC1)C=2C=COC2
Synonyms:- Benzenamine, 3-(3-furanyl)-
- 3-(3-Furanyl)benzenamine
- 3-(Furan-3-yl)aniline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.