CAS 936250-04-3

1,3-Dihydro-4-(2-methoxyphenyl)-2H-imidazol-2-one

Description:

1,3-Dihydro-4-(2-methoxyphenyl)-2H-imidazol-2-one, with the CAS number 936250-04-3, is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a methoxyphenyl group, contributing to its potential biological activity and solubility properties. The presence of the methoxy group enhances its lipophilicity, which may influence its interaction with biological membranes. The compound is likely to exhibit various chemical properties, including stability under standard conditions, but may be sensitive to light or moisture, depending on its specific formulation. Its potential applications could span pharmaceuticals, where it may serve as a scaffold for drug development, particularly in areas targeting specific biological pathways. As with many organic compounds, its reactivity can be influenced by the functional groups present, making it a candidate for further study in medicinal chemistry and related fields. Safety data and handling precautions should be consulted before working with this compound in a laboratory setting.

Formula: C₁₀H₁₀N₂O₂

InChI: InChI=1S/C10H10N2O2/c1-14-9-5-3-2-4-7(9)8-6-11-10(13)12-8/h2-6H,1H3,(H2,11,12,13)

InChI key: InChIKey=ZVNBEOIRQYISLP-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=CC=C1)C=2NC(=O)NC2

Synonyms:

• 1,3-Dihydro-4-(2-methoxyphenyl)-2H-imidazol-2-one
• 2H-Imidazol-2-one, 1,3-dihydro-4-(2-methoxyphenyl)-