CAS 936250-17-8
:2-(2,4-Dimethoxypyrimidin-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Description:
2-(2,4-Dimethoxypyrimidin-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a chemical compound characterized by its unique structure, which includes a pyrimidine ring and a dioxaborolane moiety. The presence of the dimethoxy groups on the pyrimidine enhances its solubility and reactivity, making it useful in various synthetic applications. The dioxaborolane structure contributes to its potential as a boron-containing compound, which can participate in reactions such as Suzuki coupling, a key method in organic synthesis for forming carbon-carbon bonds. This compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions, although it can be sensitive to moisture due to the presence of boron. Its applications may extend to medicinal chemistry and materials science, where boron compounds are often utilized for their unique electronic and structural properties. As with any chemical, proper handling and safety measures should be observed, particularly due to the potential reactivity of its functional groups.
Formula:C12H19BN2O4
InChI:InChI=1S/C12H19BN2O4/c1-11(2)12(3,4)19-13(18-11)8-7-14-10(17-6)15-9(8)16-5/h7H,1-6H3
InChI key:InChIKey=RKHZHTLJEUBARP-UHFFFAOYSA-N
SMILES:O(C)C=1C(=CN=C(OC)N1)B2OC(C)(C)C(C)(C)O2
Synonyms:- 2,4-Dimethoxypyrimidine-5-boronic acid pinacol ester
- 2,6-Dimethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine
- 2-(2,4-Dimethoxypyrimidin-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
- Pyrimidine, 2,4-dimethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- 2,4-Dimethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine
- 2,4-Dimethoxy-5-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)pyrimidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,4-Dimethoxypyrimidine-5-boronic acid, pinacol ester
CAS:Formula:C12H19BN2O4Purity:97%Color and Shape:SolidMolecular weight:266.10132,4-Dimethoxypyrimidine-5-boronic acid, pinacol ester
CAS:2,4-Dimethoxypyrimidine-5-boronic acid, pinacol esterPurity:98%Color and Shape:PowderMolecular weight:266.10g/mol2,4-Dimethoxypyrimidine-5-boronic acid, pinacol ester
CAS:2,4-Dimethoxypyrimidine-5-boronic acid is a high quality chemical that can be used as a reagent or a complex intermediate. It is an important building block for the synthesis of many compounds and has been shown to be useful in the synthesis of 2,4-dimethoxybenzaldehyde. This compound has been used in the preparation of 2,4-dimethoxypyrimidin-5(6H)-ones and as a reaction component in organic chemistry.Formula:C12H19BN2O4Purity:Min. 97%Molecular weight:266.1 g/mol2,4-Dimethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine
CAS:Formula:C12H19BN2O4Purity:97%Color and Shape:No data available.Molecular weight:266.1



