CymitQuimica logo

CAS 936250-26-9

:

B-[3,5-Difluoro-2-(2,2,2-trifluoroethoxy)phenyl]boronic acid

Description:
B-[3,5-Difluoro-2-(2,2,2-trifluoroethoxy)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with two fluorine atoms at the 3 and 5 positions, enhancing its electronic properties and potentially increasing its lipophilicity. Additionally, the presence of a trifluoroethoxy group contributes to its overall stability and solubility in organic solvents. This compound may exhibit interesting reactivity patterns due to the electron-withdrawing effects of the fluorine atoms, which can influence its behavior in chemical reactions. Its boronic acid functionality allows for participation in Suzuki coupling reactions, making it valuable in the synthesis of complex organic molecules. Overall, B-[3,5-Difluoro-2-(2,2,2-trifluoroethoxy)phenyl]boronic acid is a versatile compound with significant implications in both research and industrial applications.
Formula:C8H6BF5O3
InChI:InChI=1S/C8H6BF5O3/c10-4-1-5(9(15)16)7(6(11)2-4)17-3-8(12,13)14/h1-2,15-16H,3H2
InChI key:InChIKey=AZYREAMQJBZUHH-UHFFFAOYSA-N
SMILES:O(CC(F)(F)F)C1=C(B(O)O)C=C(F)C=C1F
Synonyms:
  • 2-(2,2,2-Trifluoro-Ethoxy)-3,5-Difluoro-Benzeneboronic Acid
  • B-[3,5-Difluoro-2-(2,2,2-trifluoroethoxy)phenyl]boronic acid
  • Boronic acid, B-[3,5-difluoro-2-(2,2,2-trifluoroethoxy)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.