CAS 936361-35-2
:3-(4-pyridyl)-1H-indazol-5-amine
Description:
3-(4-pyridyl)-1H-indazol-5-amine, identified by its CAS number 936361-35-2, is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a pyridine ring substituted at the 4-position, contributing to its aromatic properties and potential biological activity. The presence of the amino group at the 5-position of the indazole enhances its reactivity and solubility in polar solvents. Typically, compounds like this may exhibit various pharmacological activities, making them of interest in medicinal chemistry and drug development. The molecular structure allows for potential interactions with biological targets, which can be explored in the context of therapeutic applications. Additionally, the compound's stability, solubility, and reactivity can be influenced by the functional groups present, making it a candidate for further research in synthetic and medicinal chemistry.
Formula:C12H10N4
InChI:InChI=1/C12H10N4/c13-9-1-2-11-10(7-9)12(16-15-11)8-3-5-14-6-4-8/h1-7H,13H2,(H,15,16)
SMILES:c1cc2c(cc1N)c(c1ccncc1)n[nH]2
Synonyms:- 3-(Pyridin-4-yl)-1H-indazol-5-amin
- 3-(pyridin-4-yl)-1H-indazol-5-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
