
CAS 93639-12-4
:Cyclopropyl(4-nitrophenyl)methanone
Description:
Cyclopropyl(4-nitrophenyl)methanone, with the CAS number 93639-12-4, is an organic compound characterized by its unique structural features. It contains a cyclopropyl group, which is a three-membered carbon ring known for its strain and reactivity, attached to a 4-nitrophenyl moiety. The presence of the nitro group (-NO2) at the para position of the phenyl ring contributes to the compound's electrophilic properties, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The ketone functional group (C=O) in the methanone structure adds to its reactivity, allowing it to participate in condensation reactions and other transformations. Cyclopropyl(4-nitrophenyl)methanone may exhibit interesting physical properties, such as solubility in organic solvents and specific melting or boiling points, influenced by its molecular structure. Its applications could span across fields such as medicinal chemistry, materials science, and organic synthesis, where it may serve as an intermediate or a building block for more complex molecules.
Formula:C10H9NO3
InChI:InChI=1S/C10H9NO3/c12-10(7-1-2-7)8-3-5-9(6-4-8)11(13)14/h3-7H,1-2H2
InChI key:InChIKey=YBEFJOYAXNGQKF-UHFFFAOYSA-N
SMILES:C(=O)(C1CC1)C2=CC=C(N(=O)=O)C=C2
Synonyms:- Cyclopropyl(4-nitrophenyl)methanone
- Methanone, cyclopropyl(4-nitrophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.