CAS 936470-68-7
:7-methoxy-1H-pyrrolo[2,3-c]pyridin-4-ol
Description:
7-Methoxy-1H-pyrrolo[2,3-c]pyridin-4-ol is a heterocyclic organic compound characterized by its unique pyrrolo-pyridine structure, which incorporates both a pyrrole and a pyridine ring. This compound features a methoxy group (-OCH3) at the 7-position and a hydroxyl group (-OH) at the 4-position of the pyrrolo ring, contributing to its potential biological activity. The presence of these functional groups may enhance its solubility and reactivity, making it of interest in medicinal chemistry and drug development. The compound's molecular structure suggests potential interactions with biological targets, which could lead to pharmacological applications. Additionally, its CAS number, 936470-68-7, allows for easy identification and retrieval of information in chemical databases. Overall, 7-methoxy-1H-pyrrolo[2,3-c]pyridin-4-ol represents a class of compounds that may exhibit diverse chemical properties and biological activities, warranting further investigation in research settings.
Formula:C8H8N2O2
InChI:InChI=1/C8H8N2O2/c1-12-8-7-5(2-3-9-7)6(11)4-10-8/h2-4,9,11H,1H3
SMILES:COc1c2c(cc[nH]2)c(cn1)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.