CAS 936497-83-5
:5-Bromo-4-chloro-8-methyl-3-quinolinecarbonitrile
Description:
5-Bromo-4-chloro-8-methyl-3-quinolinecarbonitrile is a synthetic organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a bromine atom at the 5-position and a chlorine atom at the 4-position of the quinoline ring, along with a methyl group at the 8-position and a cyano group (-C≡N) at the 3-position. These substituents contribute to its unique chemical properties, including its reactivity and potential biological activity. The presence of halogens (bromine and chlorine) often enhances the compound's lipophilicity, which can influence its interaction with biological systems. The cyano group can participate in various chemical reactions, making this compound of interest in medicinal chemistry and material science. Additionally, its structural features may confer specific pharmacological properties, making it a candidate for further research in drug development or as a chemical probe in biological studies.
Formula:C11H6BrClN2
InChI:InChI=1S/C11H6BrClN2/c1-6-2-3-8(12)9-10(13)7(4-14)5-15-11(6)9/h2-3,5H,1H3
InChI key:InChIKey=WPOCMJXWTZCLEO-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C(C)=CC=C2Br)N=CC1C#N
Synonyms:- 5-Bromo-4-chloro-8-methyl-3-quinolinecarbonitrile
- 3-Quinolinecarbonitrile, 5-bromo-4-chloro-8-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.