CAS 936498-11-2

4-(1-Penten-1-yl)benzoic acid

Description:

4-(1-Penten-1-yl)benzoic acid, identified by its CAS number 936498-11-2, is an organic compound characterized by a benzoic acid moiety substituted with a 1-pentenyl group at the para position. This compound features a carbon chain with a double bond, contributing to its reactivity and potential applications in organic synthesis. The presence of the carboxylic acid functional group (-COOH) imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The unsaturated alkyl chain can also engage in addition reactions, making it versatile in synthetic chemistry. Additionally, the compound's structure suggests potential uses in materials science, pharmaceuticals, or as an intermediate in the synthesis of more complex molecules. Its physical properties, such as solubility and melting point, would typically depend on the specific conditions and purity of the sample. Overall, 4-(1-Penten-1-yl)benzoic acid is a valuable compound in the field of organic chemistry with diverse applications.

Formula: C₁₂H₁₄O₂

InChI: InChI=1S/C12H14O2/c1-2-3-4-5-10-6-8-11(9-7-10)12(13)14/h4-9H,2-3H2,1H3,(H,13,14)

InChI key: InChIKey=WPYZZVKPJHDAOE-UHFFFAOYSA-N

SMILES: C(=CCCC)C1=CC=C(C(O)=O)C=C1

Synonyms:

• 4-(1-Penten-1-yl)benzoic acid
• Benzoic acid, 4-(1-penten-1-yl)-