CymitQuimica logo

CAS 936626-74-3

:

Spiro[furo[3,4-b]pyridine-5(7H),4'-piperidin]-7-one dihydrochloride

Description:
Spiro[furo[3,4-b]pyridine-5(7H),4'-piperidin]-7-one dihydrochloride is a chemical compound characterized by its unique spirocyclic structure, which combines a furo[3,4-b]pyridine moiety with a piperidine ring. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of nitrogen atoms in its structure. The dihydrochloride form indicates that the compound is a salt, which can enhance its solubility in water and may influence its pharmacokinetic properties. The presence of multiple functional groups suggests that it may participate in various chemical reactions, making it of interest in medicinal chemistry and drug development. Additionally, the compound's specific stereochemistry and electronic properties can affect its interaction with biological targets, potentially leading to therapeutic applications. As with many heterocycles, it may also exhibit fluorescence or other optical properties, which can be useful in analytical applications. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.
Formula:C11H14Cl2N2O2
InChI:InChI=1/C11H12N2O2.2ClH/c14-10-9-8(2-1-5-13-9)11(15-10)3-6-12-7-4-11;;/h1-2,5,12H,3-4,6-7H2;2*1H
SMILES:c1cc2c(C(=O)OC32CCNCC3)nc1.Cl.Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.