CymitQuimica logo

CAS 936643-76-4

:

3-pyrimidin-2-yl-2-(pyrimidin-2-ylmethyl)propanoic acid

Description:
3-Pyrimidin-2-yl-2-(pyrimidin-2-ylmethyl)propanoic acid, with the CAS number 936643-76-4, is a chemical compound characterized by its dual pyrimidine rings and a propanoic acid functional group. This compound features a propanoic acid backbone, which contributes to its acidity and potential for forming salts or esters. The presence of pyrimidine rings, which are six-membered aromatic heterocycles containing nitrogen atoms, imparts unique electronic properties and potential biological activity. Such compounds often exhibit interactions with biological targets, making them of interest in medicinal chemistry. The structural complexity allows for various stereochemical configurations, which can influence its reactivity and interactions. Additionally, the compound's solubility, stability, and reactivity can be influenced by the presence of functional groups and the overall molecular structure. As with many pyrimidine derivatives, it may exhibit properties such as antimicrobial or antitumor activity, although specific biological effects would require empirical investigation. Overall, this compound represents a class of molecules with potential applications in pharmaceuticals and biochemistry.
Formula:C12H12N4O2
InChI:InChI=1/C12H12N4O2/c17-12(18)9(7-10-13-3-1-4-14-10)8-11-15-5-2-6-16-11/h1-6,9H,7-8H2,(H,17,18)
SMILES:c1cnc(CC(Cc2ncccn2)C(=O)O)nc1
Synonyms:
  • 2-Pyrimidinepropanoic Acid, A-(2-Pyrimidinylmethyl)-
  • 2-pyrimidinepropanoic acid, alpha-(2-pyrimidinylmethyl)-
  • 1-(PYRIMIDIN-2-YL-METHYL)-2-(PYRIMIDIN-2-YL)-PROPANOIC ACID
  • 3-(Pyrimidin-2-yl)-2-[(pyrimidin-2-yl)methyl]propanoic acid
  • α-(2-pyrimidinylmethyl)-2-pyrimidinepropanoic Acid
  • alpha-(2-Pyrimidinylmethyl)-2-pyrimidinepropanoic acid
  • 3-PYRIMIDIN-2-YL-2-PYRIMIDIN-2-YLMETHYL-PROPIONIC ACID
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.