CAS 936643-79-7
:8-piperazin-1-ylisoquinoline hydrochloride
Description:
8-Piperazin-1-ylisoquinoline hydrochloride is a chemical compound characterized by its isoquinoline structure, which is fused with a piperazine moiety. This compound typically exhibits properties associated with both isoquinoline and piperazine derivatives, including potential biological activity. It is often studied for its pharmacological properties, particularly in the context of neuropharmacology and medicinal chemistry, where it may act as a ligand for various receptors. The hydrochloride salt form enhances its solubility in water, making it suitable for biological assays and formulations. The compound's molecular structure contributes to its ability to interact with biological systems, potentially influencing neurotransmitter pathways. As with many piperazine derivatives, it may exhibit a range of effects, including anxiolytic or antipsychotic properties, depending on its specific interactions at the molecular level. Safety and handling precautions are essential, as with all chemical substances, and its use should be guided by appropriate regulatory standards and research protocols.
Formula:C13H16ClN3
InChI:InChI=1/C13H15N3.ClH/c1-2-11-4-5-15-10-12(11)13(3-1)16-8-6-14-7-9-16;/h1-5,10,14H,6-9H2;1H
SMILES:c1cc2ccncc2c(c1)N1CCNCC1.Cl
Synonyms:- 8-(Piperazin-1-Yl)Isoquinoline Hydrochloride (1:1)
- Isoquinoline, 8-(1-Piperazinyl)-, Hydrochloride (1:1)
- 8-(1-piperazinyl)-isoquinoline HCl
- 8-(1-Piperazinyl)-isoquinoline Hydrochloric Acid Salt
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.