CAS 936648-40-7

Spiro[2H-1-benzopyran-2,4′-piperidin]-4(3H)-one, 6-fluoro-, hydrochloride (1:1)

Description:

Spiro[2H-1-benzopyran-2,4′-piperidin]-4(3H)-one, 6-fluoro-, hydrochloride (1:1) is a chemical compound characterized by its unique spirocyclic structure, which combines a benzopyran moiety with a piperidine ring. The presence of a fluorine atom at the 6-position of the benzopyran enhances its biological activity and may influence its pharmacokinetic properties. As a hydrochloride salt, it is typically more soluble in water, which can facilitate its use in pharmaceutical formulations. This compound may exhibit various biological activities, potentially making it of interest in medicinal chemistry and drug development. Its specific interactions and mechanisms of action would depend on its structural features and the functional groups present. The CAS number 936648-40-7 allows for precise identification and retrieval of information regarding this substance in chemical databases. Overall, the compound's unique structural characteristics and potential biological implications make it a subject of interest in research and development within the field of chemistry and pharmacology.

Formula: C₁₃H₁₄FNO₂·ClH

InChI: InChI=1S/C13H14FNO2.ClH/c14-9-1-2-12-10(7-9)11(16)8-13(17-12)3-5-15-6-4-13;/h1-2,7,15H,3-6,8H2;1H

InChI key: InChIKey=VITABEUPCHVIAC-UHFFFAOYSA-N

SMILES: O=C1CC2(OC=3C1=CC(F)=CC3)CCNCC2.Cl

Synonyms:

• Spiro[2H-1-benzopyran-2,4′-piperidin]-4(3H)-one, 6-fluoro-, hydrochloride (1:1)
• 6-Fluorospiro[chromene-2,4′-piperidin]-4(3H)-one hydrochloride

6-FLUOROSPIRO[CHROMAN-2,4'-PIPERIDIN]-4-ONE HCL

CAS: 936648-40-7

Purity: 95.0%

Molecular weight: 271.7200012207031

Ref: 10-F388590

6-Fluorospiro[chroman-2,4'-piperidin]-4-one HCl

CAS: 936648-40-7

Versatile small molecule scaffold

Formula: C₁₃H₁₅ClFNO₂

Purity: Min. 95%

Molecular weight: 271.72 g/mol

Ref: 3D-LMB64840