CAS 93668-44-1

1H-Imidazole-1-propanamine, 2,4-dimethyl-, hydrochloride (1:2)

Description:

1H-Imidazole-1-propanamine, 2,4-dimethyl-, hydrochloride (1:2), with the CAS number 93668-44-1, is a chemical compound characterized by its imidazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features a propanamine side chain and two methyl groups at the 2 and 4 positions of the imidazole ring, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals and biochemistry. The presence of the amine group suggests potential basicity, allowing it to participate in protonation reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry for its potential therapeutic effects. Its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its handling and application.

Formula: C₈H₁₅N₃·2ClH

InChI: InChI=1S/C8H15N3.2ClH/c1-7-6-11(5-3-4-9)8(2)10-7;;/h6H,3-5,9H2,1-2H3;2*1H

InChI key: InChIKey=RTUCXOPAHOHIGG-UHFFFAOYSA-N

SMILES: C(CCN)N1C=C(C)N=C1C.Cl

Synonyms:

• 1H-Imidazole-1-propanamine, 2,4-dimethyl-, dihydrochloride
• 1H-Imidazole-1-propanamine, 2,4-dimethyl-, hydrochloride (1:2)