CAS 936694-19-8
:tert-Butyl 4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperazine-1-carboxylate
Description:
Tert-Butyl 4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperazine-1-carboxylate, identified by CAS number 936694-19-8, is a chemical compound characterized by its complex structure, which includes a piperazine ring, a tert-butyl ester group, and a boron-containing moiety. This compound is typically used in organic synthesis and medicinal chemistry due to its potential as a building block for various pharmaceuticals. The presence of the boron atom in the dioxaborolane group suggests that it may participate in reactions such as Suzuki coupling, which is valuable in forming carbon-carbon bonds. The tert-butyl group enhances the compound's lipophilicity, potentially improving its bioavailability. Additionally, the piperazine ring can contribute to the compound's pharmacological properties, making it a candidate for further investigation in drug development. Overall, this compound exemplifies the intersection of organic chemistry and medicinal applications, showcasing the importance of functional groups in determining chemical behavior and reactivity.
Formula:C22H35BN2O4
InChI:InChI=1S/C22H35BN2O4/c1-20(2,3)27-19(26)25-14-12-24(13-15-25)16-17-8-10-18(11-9-17)23-28-21(4,5)22(6,7)29-23/h8-11H,12-16H2,1-7H3
InChI key:InChIKey=AAEYFMAHSYKHGD-UHFFFAOYSA-N
SMILES:CC1(C)OB(C2=CC=C(CN3CCN(C(OC(C)(C)C)=O)CC3)C=C2)OC1(C)C
Synonyms:- 1-Piperazinecarboxylic acid, 4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-, 1,1-dimethylethyl ester
- 4-(4-Boc-1-piperazinylmethyl)benzeneboronic acid pinacol ester
- tert-Butyl 4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperazine-1-carboxylate
- tert-Butyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl]piperazine-1-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-(4-Boc-1-piperazinylmethyl)benzeneboronic acid pinacol ester, 95%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C22H35BN2O4Purity:95%Molecular weight:402.341-Piperazinecarboxylic acid, 4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-, 1,1-dimethylethyl ester
CAS:Formula:C22H35BN2O4Purity:97%Color and Shape:SolidMolecular weight:402.33534-((4-Boc-piperazine)methyl) phenylboronic acid pinacol ester
CAS:4-((4-Boc-piperazine)methyl) phenylboronic acid pinacol esterPurity:97%Color and Shape:PowderMolecular weight:402.33529g/moltert-Butyl 4-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)piperazine-1-carboxylate
CAS:Formula:C22H35BN2O4Purity:97%Molecular weight:402.344-((4-Boc-piperazine)methyl) phenylboronic acid pinacol ester
CAS:Versatile small molecule scaffoldFormula:C22H35BN2O4Purity:Min. 95%Molecular weight:402.34 g/mol




