CymitQuimica logo

CAS 93670-27-0

:

3-Benzofurancarboxylic acid, 5-methyl-, methyl ester

Description:
3-Benzofurancarboxylic acid, 5-methyl-, methyl ester, also known by its CAS number 93670-27-0, is an organic compound characterized by its benzofuran structure, which consists of a fused benzene and furan ring. This compound features a carboxylic acid functional group that is esterified with a methyl group, contributing to its classification as a methyl ester. The presence of the methyl group at the 5-position of the benzofuran ring influences its chemical reactivity and physical properties. Typically, such compounds exhibit moderate solubility in organic solvents and may have limited solubility in water due to their hydrophobic aromatic structure. They can participate in various chemical reactions, including esterification and hydrolysis. The compound may also exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its specific applications and reactivity can vary based on the functional groups present and the overall molecular structure, which can influence its interactions in chemical processes and biological systems.
Formula:C11H10O3
InChI:InChI=1S/C11H10O3/c1-7-3-4-10-8(5-7)9(6-14-10)11(12)13-2/h3-6H,1-2H3
InChI key:InChIKey=BUZKXAIBXZOEGK-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=2C(OC1)=CC=C(C)C2
Synonyms:
  • 3-Benzofurancarboxylic acid, 5-methyl-, methyl ester
  • Methyl 5-methyl-3-benzofurancarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.