CAS 936727-05-8
:Lumacaftor
Description:
Lumacaftor is a chemical compound primarily known for its role as a cystic fibrosis transmembrane conductance regulator (CFTR) corrector. It is utilized in the treatment of cystic fibrosis, particularly in patients with specific mutations in the CFTR gene, such as F508del. Lumacaftor functions by enhancing the processing and trafficking of the CFTR protein to the cell surface, thereby improving chloride ion transport and alleviating some symptoms of the disease. The compound is characterized by its molecular formula, which reflects its complex structure, and it typically exists as a solid at room temperature. Lumacaftor is often administered in combination with another CFTR modulator, ivacaftor, to maximize therapeutic efficacy. Its pharmacokinetics involve metabolism primarily through the liver, and it is known to have potential drug interactions due to its effects on liver enzymes. Safety and efficacy profiles have been established through clinical trials, leading to its approval for use in specific patient populations.
Formula:C24H18F2N2O5
InChI:InChI=1S/C24H18F2N2O5/c1-13-5-8-19(27-20(13)14-3-2-4-15(11-14)21(29)30)28-22(31)23(9-10-23)16-6-7-17-18(12-16)33-24(25,26)32-17/h2-8,11-12H,9-10H2,1H3,(H,29,30)(H,27,28,31)
InChI key:InChIKey=UFSKUSARDNFIRC-UHFFFAOYSA-N
SMILES:C(NC=1N=C(C(C)=CC1)C2=CC(C(O)=O)=CC=C2)(=O)C3(CC3)C=4C=C5C(=CC4)OC(F)(F)O5
Synonyms:- 3-(6-{[1-(2,2-Difluoro-benzo[1,3]dioxol-5-yl)-cyclopropanecarbonyl]-amino}-3-methyl-pyridin-2-yl)-benzoicacid
- 3-[6-({[1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropyl]carbonyl}amino)-3-methylpyridin-2-yl]benzoic acid
- 3-[6-[[1-(2,2-Difluoro-1,3-Benzodioxol-5-Yl)Cyclopropanecarbonyl]Amino]-3-Methyl-2-Pyridyl]Benzoic Acid
- 3-[6-[[[1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropyl]carbonyl]amino]-3-methyl-2-pyridinyl]benzoic acid
- 3-[6-[[[1-(2,2-Difluorobenzo[d][1,3]dioxol-5-yl)cyclopropyl]carbonyl]amino]-3-methylpyridin-2-yl]benzoic acid
- Benzoic Acid, 3-[6-[[[1-(2,2-Difluoro-1,3-Benzodioxol-5-Yl)Cyclopropyl]Carbonyl]Amino]-3-Methyl-2-Pyridinyl]-
- Lumacaftor
- Vrt 826809
- Vx-809
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
3-(6-[[1-(2,2-Difluoro-benzo[1,3]dioxol-5-yl)-cyclopropanecarbonyl]-amino]-3-methyl-pyridin-2-yl)-benzoic acid
CAS:Formula:C24H18F2N2O5Purity:98%Color and Shape:SolidMolecular weight:452.40693-(6-(1-(2,2-Difluorobenzo[d][1,3]Dioxol-5-Yl)Cyclopropanecarboxamido)-3-Methylpyridin-2-Yl)Benzoic Acid
CAS:3-(6-(1-(2,2-Difluorobenzo[d][1,3]Dioxol-5-Yl)Cyclopropanecarboxamido)-3-Methylpyridin-2-Yl)Benzoic AcidPurity:98%Molecular weight:452.41g/molLumacaftor (VX-809)
CAS:Formula:C24H18F2N2O5Color and Shape:White To Off-White SolidMolecular weight:452.41Lumacaftor
CAS:Lumacaftor (VRT 826809) is a CFTR modulator that corrects the folding and trafficking of CFTR protein.Formula:C24H18F2N2O5Purity:99.48% - 99.68%Color and Shape:SolidMolecular weight:452.41VX 809
CAS:Controlled Product<p>Applications VX 809 is used in the stabilization of the CFTR protein used in the treatment of cystic fibrosis.<br>References Loo, T. et al.: Biochem. Pharm., 86, 612 (2013); McPhail, G.. et al.: Drugs. Future., 37, 717 (2012);<br></p>Formula:C24H18F2N2O5Color and Shape:White To Off-WhiteMolecular weight:452.41Lumacaftor
CAS:<p>CFTR modulator</p>Formula:C24H18F2N2O5Purity:Min. 95%Color and Shape:White PowderMolecular weight:452.41 g/mol






