CAS 936728-04-0

1-(3-Hydroxy-4-methoxyphenyl)cyclopropanecarboxylic acid

Description:

1-(3-Hydroxy-4-methoxyphenyl)cyclopropanecarboxylic acid is a chemical compound characterized by its unique cyclopropane structure fused with a phenolic moiety. This compound features a cyclopropanecarboxylic acid group, which contributes to its potential acidity and reactivity. The presence of a hydroxyl group and a methoxy group on the aromatic ring enhances its solubility in polar solvents and may influence its biological activity. The hydroxyl group can participate in hydrogen bonding, while the methoxy group can affect the electronic properties of the aromatic system, potentially modulating its reactivity and interaction with biological targets. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its specific applications and effects would depend on further studies, including its synthesis, stability, and interactions with other molecules. Overall, the structural features of 1-(3-Hydroxy-4-methoxyphenyl)cyclopropanecarboxylic acid suggest a compound with potential utility in various chemical and biological contexts.

Formula: C₁₁H₁₂O₄

InChI: InChI=1S/C11H12O4/c1-15-9-3-2-7(6-8(9)12)11(4-5-11)10(13)14/h2-3,6,12H,4-5H2,1H3,(H,13,14)

InChI key: InChIKey=DQALANWWCRLIPZ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(CC1)C2=CC(O)=C(OC)C=C2

Synonyms:

• Cyclopropanecarboxylic acid, 1-(3-hydroxy-4-methoxyphenyl)-
• 1-(3-Hydroxy-4-methoxyphenyl)cyclopropane-1-carboxylic acid
• 1-(3-Hydroxy-4-methoxyphenyl)cyclopropanecarboxylic acid