
CAS 936728-18-6
:N-Ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide
Description:
N-Ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide is a chemical compound characterized by its unique structure, which includes a sulfonamide group and a boron-containing moiety. The presence of the sulfonamide functional group typically imparts properties such as increased solubility in polar solvents and potential biological activity, making it relevant in medicinal chemistry. The boron-containing dioxaborolane structure is notable for its ability to participate in various chemical reactions, including Suzuki coupling, which is significant in organic synthesis. This compound may exhibit specific reactivity patterns due to the steric hindrance provided by the tetramethyl groups, influencing its interactions with other molecules. Additionally, the ethyl group contributes to the overall lipophilicity of the compound, potentially affecting its pharmacokinetic properties. Overall, N-Ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide is a versatile compound with applications in synthetic chemistry and potentially in pharmaceutical development.
Formula:C14H22BNO4S
InChI:InChI=1S/C14H22BNO4S/c1-6-16-21(17,18)12-9-7-11(8-10-12)15-19-13(2,3)14(4,5)20-15/h7-10,16H,6H2,1-5H3
InChI key:InChIKey=HUZRQBCCTXHYLH-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC=C(S(NCC)(=O)=O)C=C2
Synonyms:- Benzenesulfonamide, N-ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- N-Ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.