CymitQuimica logo

CAS 936731-80-5

:

5-Amino-4-carboxy-1H-pyrazole-3-acetic acid

Description:
5-Amino-4-carboxy-1H-pyrazole-3-acetic acid, with the CAS number 936731-80-5, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features both amino and carboxylic acid functional groups, contributing to its potential as a versatile building block in medicinal chemistry and biochemistry. The presence of these functional groups suggests that it may exhibit properties such as solubility in polar solvents and the ability to participate in hydrogen bonding. Additionally, the compound's structure may allow for various chemical modifications, making it useful in the synthesis of more complex molecules. Its biological activity could be of interest in pharmaceutical research, particularly in the development of agents targeting specific enzymes or receptors. Overall, 5-Amino-4-carboxy-1H-pyrazole-3-acetic acid represents a significant compound for further exploration in both synthetic and medicinal chemistry contexts.
Formula:C6H7N3O4
InChI:InChI=1S/C6H7N3O4/c7-5-4(6(12)13)2(8-9-5)1-3(10)11/h1H2,(H,10,11)(H,12,13)(H3,7,8,9)
InChI key:InChIKey=MDTBXTGJSDQSEP-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(CC(O)=O)=NNC1N
Synonyms:
  • 1H-Pyrazole-3-acetic acid, 5-amino-4-carboxy-
  • 5-Amino-4-carboxy-1H-pyrazole-3-acetic acid
  • 3-Amino-5-(carboxymethyl)-1H-pyrazole-4-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.