CAS 93675-25-3

3-Methoxy-N,α-dimethylbenzeneethanamine

Description:

3-Methoxy-N,α-dimethylbenzeneethanamine, also known by its CAS number 93675-25-3, is an organic compound characterized by its amine functional group and methoxy substituent. This compound features a benzene ring with a methoxy group (-OCH₃) and a dimethylamino group attached to an ethyl chain. The presence of the methoxy group can influence its solubility and reactivity, often enhancing lipophilicity. As an amine, it may exhibit basic properties and can participate in various chemical reactions, such as alkylation or acylation. The compound's structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis. Its specific physical and chemical properties, such as boiling point, melting point, and solubility, would depend on the molecular interactions and the overall structure. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage and minimize risks associated with exposure.

Formula: C₁₁H₁₇NO

InChI: InChI=1S/C11H17NO/c1-9(12-2)7-10-5-4-6-11(8-10)13-3/h4-6,8-9,12H,7H2,1-3H3

InChI key: InChIKey=USQWRDRXXKZFDI-UHFFFAOYSA-N

SMILES: C(C(NC)C)C1=CC(OC)=CC=C1

Synonyms:

• Phenethylamine, m-methoxy-N,α-dimethyl-
• Benzeneethanamine, 3-methoxy-N,α-dimethyl-, (±)-
• 3-Methoxymethamphetamine
• Benzeneethanamine, 3-methoxy-N,α-dimethyl-
• 3-Methoxy-N,α-dimethylbenzeneethanamine

Benzeneethanamine, 3-methoxy-N,α-dimethyl-

CAS: 93675-25-3

Formula: C₁₁H₁₇NO

Molecular weight: 179.2588

Ref: IN-DA000LNT