CAS 93677-89-5

4-amino-5-(2,4-dichlorophenyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

4-amino-5-(2,4-dichlorophenyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione, with the CAS number 93677-89-5, is a chemical compound that belongs to the class of triazoles, which are five-membered heterocyclic compounds containing three nitrogen atoms. This substance features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, which contributes to its reactivity and potential biological activity. The dichlorophenyl substituent enhances its lipophilicity and may influence its interaction with biological targets. The amino group provides sites for hydrogen bonding, which can be crucial for its solubility and interaction with other molecules. This compound is of interest in various fields, including medicinal chemistry and agricultural applications, due to its potential as a fungicide or herbicide. Its specific properties, such as solubility, stability, and reactivity, can vary based on environmental conditions and the presence of other chemical species. Safety and handling precautions should be observed, as with any chemical substance, to mitigate potential hazards.

Formula: C₈H₆Cl₂N₄S

InChI: InChI=1/C8H6Cl2N4S/c9-4-1-2-5(6(10)3-4)7-12-13-8(15)14(7)11/h1-3H,11H2,(H,13,15)

SMILES: c1cc(c(cc1Cl)Cl)c1nnc(n1N)S

Synonyms:

• 4-Amino-5-(2,4-dichlorophenyl)-3-mercapto-4H-1,2,4-triazole
• 4-Amino-5-(2,4-dichlorophenyl)-4H-1,2,4-triazole-3-thiol
• 4H-1,2,4-triazole-3-thiol, 4-amino-5-(2,4-dichlorophenyl)-
• 3H-1,2,4-Triazole-3-thione, 4-amino-5-(2,4-dichlorophenyl)-2,4-dihydro-
• 4-amino-5-(2,4-dichlorophenyl)-2H-1,2,4-triazole-3-thione

4-Amino-3-(2,4-dichlorophenyl)-5-mercapto-4H-1,2,4-triazole

CAS: 93677-89-5

4-Amino-3-(2,4-dichlorophenyl)-5-mercapto-4H-1,2,4-triazole

Purity: ≥95%

Molecular weight: 261.13g/mol

Ref: 54-OR2030

4-Amino-5-(2,4-dichloro-phenyl)-4H-[1,2,4]triazole-3-thiol

CAS: 93677-89-5

Formula: C₈H₆Cl₂N₄S

Molecular weight: 261.12

Ref: 10-F344628