CAS 936850-10-1

Ethyl 1-[(1,1-dimethylethoxy)carbonyl]-3-hydroxy-α,α-dimethyl-3-azetidineacetate

Description:

Ethyl 1-[(1,1-dimethylethoxy)carbonyl]-3-hydroxy-α,α-dimethyl-3-azetidineacetate, identified by its CAS number 936850-10-1, is a chemical compound characterized by its unique azetidine ring structure, which contributes to its potential biological activity. This compound features an ethyl ester functional group, enhancing its solubility and reactivity. The presence of a hydroxy group indicates potential for hydrogen bonding, which may influence its interaction with biological targets. The dimethylethoxycarbonyl group serves as a protective or modifying group, often utilized in organic synthesis to enhance stability or selectivity during reactions. The overall structure suggests that it may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties could be explored through various analytical methods such as NMR, IR spectroscopy, and mass spectrometry. As with many compounds, understanding its reactivity and potential applications would require comprehensive studies, including biological assays and toxicity evaluations.

Formula: C₁₄H₂₅NO₅

InChI: InChI=1S/C14H25NO5/c1-7-19-10(16)13(5,6)14(18)8-15(9-14)11(17)20-12(2,3)4/h18H,7-9H2,1-6H3

InChI key: InChIKey=YMCBJSPGMCTBSK-UHFFFAOYSA-N

SMILES: C(C(OCC)=O)(C)(C)C1(O)CN(C(OC(C)(C)C)=O)C1

Synonyms:

• Ethyl 1-[(1,1-dimethylethoxy)carbonyl]-3-hydroxy-α,α-dimethyl-3-azetidineacetate
• 3-Azetidineacetic acid, 1-[(1,1-dimethylethoxy)carbonyl]-3-hydroxy-α,α-dimethyl-, ethyl ester

TERT-BUTYL 3-(1-ETHOXY-2-METHYL-1-OXOPROPAN-2-YL)-3-HYDROXYAZETIDINE-1-CARBOXYLATE

CAS: 936850-10-1

Formula: C₁₄H₂₅NO₅

Purity: 90.0%

Molecular weight: 287.356

Ref: 10-F530782