
CAS 936850-79-2
:4-[4-(Trifluoromethyl)phenyl]-2-thiazolepropanol
Description:
4-[4-(Trifluoromethyl)phenyl]-2-thiazolepropanol is a chemical compound characterized by its unique structural features, including a thiazole ring and a trifluoromethyl group. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in pharmaceutical research. The thiazole moiety contributes to the compound's potential reactivity and interaction with various biological targets. This compound may exhibit properties such as antimicrobial, antifungal, or anti-inflammatory activities, depending on its specific interactions within biological systems. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. As with many organic compounds, safety and handling precautions are essential, particularly due to the presence of fluorinated groups, which can pose environmental and health risks. Overall, 4-[4-(Trifluoromethyl)phenyl]-2-thiazolepropanol represents a class of compounds that are valuable in medicinal chemistry and material science.
Formula:C13H12F3NOS
InChI:InChI=1S/C13H12F3NOS/c14-13(15,16)10-5-3-9(4-6-10)11-8-19-12(17-11)2-1-7-18/h3-6,8,18H,1-2,7H2
InChI key:InChIKey=DDYRBGUYBFBOHO-UHFFFAOYSA-N
SMILES:C(CCO)C1=NC(=CS1)C2=CC=C(C(F)(F)F)C=C2
Synonyms:- 4-[4-(Trifluoromethyl)phenyl]-2-thiazolepropanol
- 2-Thiazolepropanol, 4-[4-(trifluoromethyl)phenyl]-
- 3-[4-(4-Trifluoromethylphenyl)thiazol-2-yl]-propan-1-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.