
CAS 936901-74-5
:cis-3-(1-Bromo-8-chloroimidazo[1,5-a]pyrazin-3-yl)-1-methylcyclobutanol
Description:
Cis-3-(1-Bromo-8-chloroimidazo[1,5-a]pyrazin-3-yl)-1-methylcyclobutanol is a complex organic compound characterized by its unique structural features, including a cyclobutanol moiety and a substituted imidazo[1,5-a]pyrazine ring. The presence of bromine and chlorine atoms in its structure contributes to its reactivity and potential biological activity. This compound is likely to exhibit specific stereochemistry due to the "cis" configuration, which can influence its interactions with biological targets. The hydroxyl group in the cyclobutanol portion may impart solubility in polar solvents and facilitate hydrogen bonding, affecting its pharmacokinetic properties. Additionally, the imidazo[1,5-a]pyrazine framework is often associated with various pharmacological activities, making this compound of interest in medicinal chemistry. Its CAS number, 936901-74-5, allows for precise identification in chemical databases, facilitating research and development efforts. Overall, the characteristics of this compound suggest potential applications in drug discovery and development, particularly in areas targeting specific biological pathways.
Formula:C11H11BrClN3O
InChI:InChI=1/C11H11BrClN3O/c1-11(17)4-6(5-11)10-15-8(12)7-9(13)14-2-3-16(7)10/h2-3,6,17H,4-5H2,1H3/t6-,11+
InChI key:InChIKey=BHANQQWNLCKMCA-JCJUMFQONA-N
SMILES:BrC=1N=C(N2C1C(Cl)=NC=C2)[C@H]3C[C@@](C)(O)C3
Synonyms:- 1-Bromo-8-chloro-3-(cis-3-hydroxy-3-methylcyclobutyl)imidazo[3,4-a]pyrazine
- cis-3-(1-Bromo-8-chloroimidazo[1,5-a]pyrazin-3-yl)-1-methylcyclobutanol
- Cyclobutanol, 3-(1-bromo-8-chloroimidazo[1,5-a]pyrazin-3-yl)-1-methyl-, cis-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.