CymitQuimica logo

CAS 936901-91-6

:

1,2-Diphenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazole

Description:
1,2-Diphenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazole is a complex organic compound characterized by its unique structural features, which include a benzimidazole core and a boron-containing moiety. The presence of the dioxaborolane group enhances its potential for applications in organic synthesis and materials science, particularly in the development of boron-based catalysts and ligands. This compound typically exhibits good thermal stability and solubility in organic solvents, making it suitable for various chemical reactions. Its molecular structure allows for potential interactions with biological systems, which may be explored in medicinal chemistry. Additionally, the presence of multiple phenyl groups contributes to its electronic properties, potentially influencing its reactivity and photophysical behavior. Overall, this compound represents a versatile building block in synthetic organic chemistry, with implications for both industrial and research applications.
Formula:C25H25BN2O2
InChI:InChI=1S/C25H25BN2O2/c1-24(2)25(3,4)30-26(29-24)19-15-16-22-21(17-19)27-23(18-11-7-5-8-12-18)28(22)20-13-9-6-10-14-20/h5-17H,1-4H3
InChI key:InChIKey=PLGAGTXQDPNYDY-UHFFFAOYSA-N
SMILES:CC1(C)OB(C=2C=C3C(N(C(=N3)C4=CC=CC=C4)C5=CC=CC=C5)=CC2)OC1(C)C
Synonyms:
  • 1,2-Diphenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[d]imidazole
  • 1,2-Diphenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazole
  • 1H-Benzimidazole, 1,2-diphenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.