CymitQuimica logo

CAS 936923-58-9

:

Ethyl 5-bromobenzo[d]isothiazole-3-carboxylate

Description:
Ethyl 5-bromobenzo[d]isothiazole-3-carboxylate is a chemical compound characterized by its unique structure, which includes a benzo[d]isothiazole core substituted with a bromine atom and an ethyl ester functional group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the isothiazole moiety. It is likely to be a solid at room temperature, with moderate solubility in organic solvents, reflecting the influence of its aromatic and heterocyclic components. The presence of the bromine atom may enhance its reactivity and influence its interactions in various chemical reactions. Ethyl 5-bromobenzo[d]isothiazole-3-carboxylate may be of interest in medicinal chemistry and material science, potentially serving as a precursor for the synthesis of more complex molecules or as a building block in drug development. Safety data should be consulted for handling and usage, as halogenated compounds can exhibit varying degrees of toxicity and environmental impact.
Formula:C10H8BrNO2S
InChI:InChI=1/C10H8BrNO2S/c1-2-14-10(13)9-7-5-6(11)3-4-8(7)15-12-9/h3-5H,2H2,1H3
SMILES:CCOC(=O)c1c2cc(ccc2sn1)Br
Synonyms:
  • 5-Bromo-1,2-benzisothiazole-3-carboxylic acid ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.