CymitQuimica logo

CAS 93693-01-7

:

4-(4-Ethylphenyl)-3-thiosemicarbazide

Description:
4-(4-Ethylphenyl)-3-thiosemicarbazide is an organic compound characterized by its thiosemicarbazide functional group, which features a thiocarbonyl (C=S) moiety. This compound typically appears as a solid and is known for its potential biological activities, including antimicrobial and anticancer properties. The presence of the ethylphenyl group contributes to its hydrophobic characteristics, influencing its solubility in organic solvents. Thiosemicarbazides are often studied for their ability to form coordination complexes with metal ions, which can enhance their pharmacological effects. The compound's structure includes a thiosemicarbazide backbone, which is essential for its reactivity and interaction with various biological targets. Additionally, it may exhibit a range of physical properties such as melting point and boiling point, which are influenced by its molecular structure and intermolecular interactions. Overall, 4-(4-Ethylphenyl)-3-thiosemicarbazide is of interest in medicinal chemistry and materials science due to its diverse applications and potential therapeutic benefits.
Formula:C9H13N3S
InChI:InChI=1/C9H13N3S/c1-2-7-3-5-8(6-4-7)11-9(13)12-10/h3-6H,2,10H2,1H3,(H2,11,12,13)
SMILES:CCc1ccc(cc1)NC(=NN)S
Synonyms:
  • N-(4-ethylphenyl)hydrazinecarbothioamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.