CAS 936939-85-4

1-(1,5-dimethyl-1H-pyrazol-4-yl)ethanamine

Description:

1-(1,5-Dimethyl-1H-pyrazol-4-yl)ethanamine, with the CAS number 936939-85-4, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a 1,5-dimethyl substitution on the pyrazole ring, contributing to its unique chemical properties. The ethanamine moiety indicates the presence of an ethylamine group, which introduces basic amine characteristics. This compound is likely to exhibit moderate solubility in polar solvents due to the presence of the amine functional group, while its pyrazole structure may impart some degree of hydrophobicity. Additionally, the presence of methyl groups can influence its steric properties and reactivity. Such compounds are often of interest in medicinal chemistry and may exhibit biological activity, making them potential candidates for drug development. Overall, the combination of the pyrazole and amine functionalities suggests a versatile compound with potential applications in various chemical and pharmaceutical contexts.

Formula: C₇H₁₃N₃

InChI: InChI=1/C7H13N3/c1-5(8)7-4-9-10(3)6(7)2/h4-5H,8H2,1-3H3

SMILES: CC(c1cnn(C)c1C)N

Synonyms:

• 1H-Pyrazole-4-methanamine, α,1,5-trimethyl-

1-(1,5-Dimethyl-1H-pyrazol-4-yl)ethanamine

CAS: 936939-85-4

Formula: C₇H₁₃N₃

Molecular weight: 139.1982

Ref: IN-DA006EN9

1-(1,5-Dimethyl-1H-pyrazol-4-yl)ethanamine

CAS: 936939-85-4

1-(1,5-Dimethyl-1H-pyrazol-4-yl)ethanamine

Purity: 95%

Molecular weight: 139.20g/mol

Ref: 54-OR930112

1-(1,5-Dimethyl-1 H -pyrazol-4-yl)-ethylamine

CAS: 936939-85-4

Formula: C₇H₁₃N₃

Purity: 95.0%

Molecular weight: 139.202

Ref: 10-F030424