CAS 936940-07-7
:4-(4-Hydroxyphenyl)-1,2,4-triazole
Description:
4-(4-Hydroxyphenyl)-1,2,4-triazole is an organic compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a hydroxyphenyl group, indicating the presence of a hydroxyl (-OH) group attached to a phenyl ring, which contributes to its potential as a phenolic compound. The presence of both the triazole and hydroxy groups suggests that this substance may exhibit interesting chemical properties, including potential antioxidant activity and the ability to form hydrogen bonds. It may also participate in various chemical reactions, such as nucleophilic substitutions or coordination with metal ions. The compound's structure allows for potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Additionally, its solubility and stability in different solvents can vary, influencing its reactivity and application in various fields. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C6H12N2O2
InChI:InChI=1/C6H12N2O2/c7-2-4-8-3-1-5-10-6(8)9/h1-5,7H2
SMILES:C1CN(CCN)C(=O)OC1
Synonyms:- 4-(4H-1,2,4-Triazol-4-yl)phenol
- 4-(4-(2-bromoethoxy)phenyl)-4H-1,2,4-triazole
- 4-(1,2,4-Triazol-4-Yl)Phenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
