CAS 936940-10-2

1-Propanone, 1-[3-(aminomethyl)-1-piperidinyl]-2-methyl-

Description:

1-Propanone, 1-[3-(aminomethyl)-1-piperidinyl]-2-methyl-, also known by its CAS number 936940-10-2, is a chemical compound characterized by its ketone functional group and a piperidine ring. This substance features a propanone backbone with a methyl group and an aminomethyl substituent on the piperidine ring, which contributes to its potential biological activity. The presence of the piperidine moiety suggests that it may interact with biological systems, possibly influencing neurotransmitter pathways or exhibiting pharmacological properties. Typically, compounds of this nature are evaluated for their solubility, stability, and reactivity, which can vary based on the specific functional groups present. Additionally, the compound's molecular structure may impart specific characteristics such as lipophilicity or hydrophilicity, affecting its behavior in biological systems and its potential applications in medicinal chemistry. Safety and handling considerations are essential, as with all chemical substances, particularly those with biological activity.

Formula: C₁₀H₂₀N₂O

InChI: InChI=1S/C10H20N2O/c1-8(2)10(13)12-5-3-4-9(6-11)7-12/h8-9H,3-7,11H2,1-2H3

InChI key: InChIKey=ZKCIECGBLAHYON-UHFFFAOYSA-N

SMILES: C(C(C)C)(=O)N1CC(CN)CCC1

Synonyms:

• 1-[3-(Aminomethyl)Piperidin-1-Yl]-2-Methylpropan-1-One
• 1-Propanone, 1-[3-(Aminomethyl)-1-Piperidinyl]-2-Methyl-