CAS 936940-12-4
:α,1,3,5-Tetramethyl-1H-pyrazole-4-methanamine
Description:
α,1,3,5-Tetramethyl-1H-pyrazole-4-methanamine, with the CAS number 936940-12-4, is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features four methyl groups attached to the pyrazole ring, contributing to its stability and lipophilicity. The presence of a methanamine group enhances its reactivity, making it a potential candidate for various chemical reactions. Typically, compounds of this nature may exhibit properties such as moderate solubility in organic solvents and limited solubility in water, depending on the specific functional groups present. The presence of multiple methyl groups can influence the compound's steric hindrance and electronic properties, potentially affecting its interactions in biological systems or its utility in synthetic applications. As with many nitrogen-containing heterocycles, it may also exhibit interesting pharmacological properties, although specific biological activities would require further investigation. Safety data and handling precautions should be consulted when working with this compound, as with all chemical substances.
Formula:C8H15N3
InChI:InChI=1S/C8H15N3/c1-5(9)8-6(2)10-11(4)7(8)3/h5H,9H2,1-4H3
InChI key:InChIKey=ZTWKRDLLRAVAFV-UHFFFAOYSA-N
SMILES:C(C)(N)C1=C(C)N(C)N=C1C
Synonyms:- 1-(1,3,5-Trimethylpyrazol-4-yl)ethanamine
- 1-(Trimethyl-1H-pyrazol-4-yl)ethan-1-amine
- 1H-pyrazole-4-methanamine, α,1,3,5-tetramethyl-
- α,1,3,5-Tetramethyl-1H-pyrazole-4-methanamine
- 1-(1,3,5-Trimethyl-1H-pyrazol-4-yl)ethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
