CymitQuimica logo

CAS 936940-14-6

:

1-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)methanamine

Description:
1-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)methanamine, identified by its CAS number 936940-14-6, is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an ethyl group and two methyl groups attached to the pyrazole, contributing to its unique properties. The presence of the methanamine functional group indicates that it has an amine component, which can participate in hydrogen bonding and may influence its solubility and reactivity. Generally, compounds like this can exhibit biological activity, making them of interest in medicinal chemistry and drug development. The specific arrangement of substituents on the pyrazole ring can affect the compound's pharmacological properties, including its potential as a ligand for various biological targets. Additionally, the molecular structure suggests that it may have applications in agrochemicals or as a building block in organic synthesis. Overall, the characteristics of this compound are defined by its structural features and functional groups, which dictate its chemical behavior and potential applications.
Formula:C8H15N3
InChI:InChI=1/C8H15N3/c1-4-11-7(3)8(5-9)6(2)10-11/h4-5,9H2,1-3H3
SMILES:CCn1c(C)c(CN)c(C)n1
Synonyms:
  • 1H-pyrazole-4-methanamine, 1-ethyl-3,5-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.