CymitQuimica logo

CAS 936940-28-2

:

3-(2-Pyridinyl)-1,2,4-oxadiazole-5-ethanamine

Description:
3-(2-Pyridinyl)-1,2,4-oxadiazole-5-ethanamine is a chemical compound characterized by its unique structure, which includes a pyridine ring and an oxadiazole moiety. This compound typically exhibits properties such as moderate solubility in polar solvents, which is influenced by the presence of the amino group and the heterocyclic structure. It may display biological activity, making it of interest in medicinal chemistry and drug development. The oxadiazole ring is known for its potential in various applications, including as a building block in pharmaceuticals and agrochemicals. Additionally, the presence of the pyridine ring can enhance the compound's ability to interact with biological targets, potentially leading to various pharmacological effects. The compound's stability, reactivity, and interaction with other molecules can vary based on environmental conditions such as pH and temperature. Overall, 3-(2-Pyridinyl)-1,2,4-oxadiazole-5-ethanamine represents a versatile structure with potential applications in diverse fields, including medicinal chemistry and materials science.
Formula:C9H10N4O
InChI:InChI=1S/C9H10N4O/c10-5-4-8-12-9(13-14-8)7-3-1-2-6-11-7/h1-3,6H,4-5,10H2
InChI key:InChIKey=ADSGQVPBHDUDMR-UHFFFAOYSA-N
SMILES:C(CN)C1=NC(=NO1)C2=CC=CC=N2
Synonyms:
  • 2-[3-(Pyridin-2-yl)-1,2,4-oxadiazol-5-yl]ethan-1-amine
  • 2-(3-Pyridin-2-yl-1,2,4-oxadiazol-5-yl)ethanamine
  • 2-[3-(Pyridin-2-yl)-1,2,4-oxadiazol-5-yl]ethanamine
  • 3-(2-Pyridinyl)-1,2,4-oxadiazole-5-ethanamine
  • 1,2,4-Oxadiazole-5-ethanamine, 3-(2-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.