CAS 936940-34-0
:1-(3,5-dimethyl-1H-pyrazol-1-yl)propan-2-amine
Description:
1-(3,5-Dimethyl-1H-pyrazol-1-yl)propan-2-amine, with the CAS number 936940-34-0, is an organic compound characterized by its pyrazole ring structure, which contributes to its unique chemical properties. This compound features a propan-2-amine moiety, indicating the presence of an amine functional group that can participate in hydrogen bonding and influence its reactivity. The two methyl groups on the pyrazole ring enhance its lipophilicity, potentially affecting its solubility in organic solvents and biological systems. The presence of the amine group suggests that it may exhibit basic properties, making it a candidate for various chemical reactions, including alkylation and acylation. Additionally, the compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with pyrazole derivatives. Its stability, reactivity, and potential interactions with biological targets would depend on the specific conditions and environments in which it is used.
Formula:C8H15N3
InChI:InChI=1/C8H15N3/c1-6(9)5-11-8(3)4-7(2)10-11/h4,6H,5,9H2,1-3H3
SMILES:CC(Cn1c(C)cc(C)n1)N
Synonyms:- 1H-pyrazole-1-ethanamine, alpha,3,5-trimethyl-
- 2-(3,5-Dimethyl-pyrazol-1-yl)-1-methyl-ethylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
