CAS 936940-49-7
:[1-(2-methoxyethyl)-3-piperidyl]methanamine
Description:
[1-(2-methoxyethyl)-3-piperidyl]methanamine, with the CAS number 936940-49-7, is a chemical compound characterized by its piperidine structure, which includes a methanamine functional group and a methoxyethyl substituent. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The presence of the methoxyethyl group may enhance its lipophilicity, potentially affecting its pharmacokinetic properties if it is biologically active. Additionally, the piperidine ring contributes to the compound's conformational flexibility, which can be significant in interactions with biological targets. The compound's specific applications or biological activities would depend on its structural features and the context of its use, such as in medicinal chemistry or as a research tool. Overall, [1-(2-methoxyethyl)-3-piperidyl]methanamine represents a unique molecular framework that may be of interest in various chemical and pharmaceutical research areas.
Formula:C9H20N2O
InChI:InChI=1/C9H20N2O/c1-12-6-5-11-4-2-3-9(7-10)8-11/h9H,2-8,10H2,1H3
SMILES:COCCN1CCCC(CN)C1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-[1-(2-methoxyethyl)piperidin-3-yl]methanamine
CAS:Controlled ProductApplications 1-[1-(2-methoxyethyl)piperidin-3-yl]methanamine (cas# 936940-49-7) is a useful research chemical.
Formula:C9H20N2OColor and Shape:NeatMolecular weight:172.268
