CAS 936940-54-4
:3-(2-aminophenyl)oxazolidin-2-one
Description:
3-(2-Aminophenyl)oxazolidin-2-one, with the CAS number 936940-54-4, is a heterocyclic organic compound characterized by the presence of an oxazolidinone ring fused with an aniline derivative. This compound typically exhibits a white to off-white crystalline appearance. It features a five-membered ring containing both nitrogen and oxygen atoms, which contributes to its potential biological activity. The amino group on the phenyl ring can participate in hydrogen bonding, enhancing its solubility in polar solvents. This compound may exhibit properties such as antibacterial or antifungal activity, making it of interest in medicinal chemistry. Its structure allows for various functional modifications, which can influence its pharmacological properties. Additionally, the presence of the oxazolidinone moiety suggests potential applications in the development of new therapeutic agents, particularly in the field of antibiotics. As with many organic compounds, its stability, reactivity, and interactions with other substances can vary based on environmental conditions such as pH and temperature.
Formula:C9H10N2O2
InChI:InChI=1/C9H10N2O2/c10-7-3-1-2-4-8(7)11-5-6-13-9(11)12/h1-4H,5-6,10H2
SMILES:c1ccc(c(c1)N)N1CCOC1=O
Synonyms:- 2-Oxazolidinone, 3-(2-Aminophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.