CAS 936940-66-8
:5-(1,1-Dimethylethyl)-1H-pyrazole-3-methanamine
Description:
5-(1,1-Dimethylethyl)-1H-pyrazole-3-methanamine, identified by its CAS number 936940-66-8, is a chemical compound that features a pyrazole ring substituted with a tert-butyl group and an amine functional group. This compound is characterized by its unique structure, which includes a five-membered heterocyclic ring containing two nitrogen atoms. The tert-butyl group contributes to its steric bulk, potentially influencing its reactivity and interactions with biological targets. The presence of the amine group suggests that it may participate in hydrogen bonding and could exhibit basic properties. This compound may be of interest in various fields, including medicinal chemistry and agrochemicals, due to its potential biological activity. Its solubility, stability, and reactivity would depend on the specific conditions and solvents used. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C8H15N3
InChI:InChI=1S/C8H15N3/c1-8(2,3)7-4-6(5-9)10-11-7/h4H,5,9H2,1-3H3,(H,10,11)
InChI key:InChIKey=UPXAEMPLVMJWAL-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C1=CC(CN)=NN1
Synonyms:- 5-(1,1-Dimethylethyl)-1H-pyrazole-3-methanamine
- (5-tert-Butyl-1H-pyrazol-3-yl)methanamine
- (3-tert-Butyl-1H-pyrazol-5-yl)methylamine
- 1H-Pyrazole-3-methanamine, 5-(1,1-dimethylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.