CAS 936940-75-9

3-(3,5-dimethyl-1H-pyrazol-4-yl)propan-1-amine

Description:

3-(3,5-dimethyl-1H-pyrazol-4-yl)propan-1-amine, with the CAS number 936940-75-9, is an organic compound characterized by its pyrazole ring structure and a propan-1-amine side chain. This compound features a pyrazole moiety substituted at the 3 and 5 positions with methyl groups, which can influence its biological activity and solubility. The presence of the amine group suggests that it may exhibit basic properties, allowing it to participate in hydrogen bonding and potentially interact with various biological targets. Its molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's stability, reactivity, and solubility in different solvents can vary based on environmental conditions and the presence of functional groups. Overall, 3-(3,5-dimethyl-1H-pyrazol-4-yl)propan-1-amine is of interest for its potential roles in drug discovery and development, particularly in areas related to neurochemistry and pharmacology.

Formula: C₈H₁₅N₃

InChI: InChI=1/C8H15N3/c1-6-8(4-3-5-9)7(2)11-10-6/h3-5,9H2,1-2H3,(H,10,11)

SMILES: Cc1c(CCCN)c(C)n[nH]1

Synonyms:

• 1H-pyrazole-4-propanamine, 3,5-dimethyl-