CAS 936940-76-0
:2-Hydrazinyl-5,6-dihydro-8-methoxybenzo[h]quinazoline
Description:
2-Hydrazinyl-5,6-dihydro-8-methoxybenzo[h]quinazoline is a chemical compound characterized by its unique structure, which includes a hydrazine functional group and a quinazoline core. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, which may include antimicrobial or anticancer effects, although specific biological data may vary. The presence of the methoxy group suggests it may have enhanced solubility and stability in various solvents. Additionally, the dihydroquinazoline structure may contribute to its reactivity and interaction with biological targets. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Safety data should be consulted for handling and storage, as compounds with hydrazine moieties can be hazardous. Overall, 2-Hydrazinyl-5,6-dihydro-8-methoxybenzo[h]quinazoline represents a class of compounds that may have significant implications in medicinal chemistry and drug development.
Formula:C13H14N4O
InChI:InChI=1S/C13H14N4O/c1-18-10-4-5-11-8(6-10)2-3-9-7-15-13(17-14)16-12(9)11/h4-7H,2-3,14H2,1H3,(H,15,16,17)
InChI key:InChIKey=WFAZWNKWTXGYMO-UHFFFAOYSA-N
SMILES:N(N)=C1NC=2C=3C(=CC(OC)=CC3)CCC2C=N1
Synonyms:- (8-Methoxy-5,6-dihydro-benzo[h]quinazolin-2-yl)-hydrazine
- Benzo[h]quinazoline, 2-hydrazinyl-5,6-dihydro-8-methoxy-
- (8-Methoxy-5,6-dihydrobenzo[h]quinazolin-2-yl)hydrazine
- 2-Hydrazinyl-8-methoxy-5H,6H-benzo[h]quinazoline
- 2-Hydrazinyl-5,6-dihydro-8-methoxybenzo[h]quinazoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.