CAS 936940-93-1
:B-(2-Methyl-4-quinolinyl)boronic acid
Description:
B-(2-Methyl-4-quinolinyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a quinoline derivative. This compound typically exhibits properties such as being a white to off-white solid, with moderate solubility in polar solvents like water and alcohols, owing to the boronic acid moiety. The presence of the quinoline ring contributes to its aromatic character, which can influence its reactivity and interactions with other chemical species. Boronic acids are known for their ability to form reversible covalent bonds with diols, making them valuable in various applications, including organic synthesis and medicinal chemistry. Additionally, this compound may exhibit biological activity, potentially serving as a building block in drug development or as a ligand in coordination chemistry. Its specific reactivity and applications can vary based on the functional groups present and the overall molecular structure. As with many boronic acids, care should be taken in handling due to potential reactivity with moisture and other nucleophiles.
Formula:C10H10BNO2
InChI:InChI=1S/C10H10BNO2/c1-7-6-9(11(13)14)8-4-2-3-5-10(8)12-7/h2-6,13-14H,1H3
InChI key:InChIKey=IOGHNYQWDYHXCI-UHFFFAOYSA-N
SMILES:B(O)(O)C=1C2=C(N=C(C)C1)C=CC=C2
Synonyms:- Boronic acid, B-(2-methyl-4-quinolinyl)-
- B-(2-Methyl-4-quinolinyl)boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
