CAS 936940-94-2
:B-(3,6-Dimethyl-2-pyrazinyl)boronic acid
Description:
B-(3,6-Dimethyl-2-pyrazinyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyrazine ring. This compound features a pyrazine moiety with two methyl groups at the 3 and 6 positions, which can influence its solubility and reactivity. Boronic acids are known for their ability to form reversible covalent bonds with diols, making them valuable in various applications, including organic synthesis, medicinal chemistry, and materials science. The presence of the pyrazine ring may impart specific electronic properties and enhance interactions with biological targets. Additionally, this compound may exhibit properties such as moderate stability under ambient conditions and potential reactivity in cross-coupling reactions, which are essential in the formation of carbon-carbon bonds. Its unique structure and functional groups make it a candidate for further research in drug development and catalysis. As with all chemical substances, proper handling and safety precautions should be observed due to potential hazards associated with boronic acids.
Formula:C6H9BN2O2
InChI:InChI=1S/C6H9BN2O2/c1-4-3-8-5(2)6(9-4)7(10)11/h3,10-11H,1-2H3
InChI key:InChIKey=IJHSADBWIZLMQX-UHFFFAOYSA-N
SMILES:B(O)(O)C=1C(C)=NC=C(C)N1
Synonyms:- Boronic acid, B-(3,6-dimethyl-2-pyrazinyl)-
- B-(3,6-Dimethyl-2-pyrazinyl)boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
