CAS 937-23-5
:4-Bromo-N-methyl-N-nitrosobenzenamine
Description:
4-Bromo-N-methyl-N-nitrosobenzenamine, with the CAS number 937-23-5, is a chemical compound that belongs to the class of nitrosamines, which are known for their potential carcinogenic properties. This compound features a bromine atom and a nitroso group attached to a benzenamine structure, which contributes to its reactivity and biological activity. It is typically a solid at room temperature and may exhibit a range of physical properties such as solubility in organic solvents. The presence of the nitroso group makes it susceptible to reduction reactions, and it can participate in various chemical transformations. Due to its structure, it may also engage in electrophilic aromatic substitution reactions. Safety considerations are paramount when handling this compound, as nitrosamines are often associated with health risks, including potential carcinogenic effects. Proper laboratory protocols should be followed to minimize exposure and ensure safe handling.
Formula:C7H7BrN2O
InChI:InChI=1S/C7H7BrN2O/c1-10(9-11)7-4-2-6(8)3-5-7/h2-5H,1H3
InChI key:InChIKey=ALPCWHBDOURDHG-UHFFFAOYSA-N
SMILES:N(N=O)(C)C1=CC=C(Br)C=C1
Synonyms:- p-Bromo-N-nitroso-N-methylaniline
- Benzenamine, 4-bromo-N-methyl-N-nitroso-
- 4-Bromo-N-nitroso-N-methylaniline
- Aniline, p-bromo-N-methyl-N-nitroso-
- 4-Bromo-N-methyl-N-nitrosobenzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
