CAS 937-27-9

1H-pyrrole-2,5-dicarboxylic acid

Description:

1H-Pyrrole-2,5-dicarboxylic acid, with the CAS number 937-27-9, is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features two carboxylic acid groups (-COOH) located at the 2 and 5 positions of the pyrrole ring, contributing to its acidity and reactivity. It is typically a white to off-white solid that is soluble in water and polar organic solvents due to the presence of the carboxylic acid groups. The compound is of interest in various fields, including organic synthesis and materials science, as it can serve as a building block for more complex molecules and polymers. Its derivatives may exhibit interesting biological activities, making it a subject of research in medicinal chemistry. Additionally, the presence of the carboxylic acid groups allows for potential interactions with other chemical species, enhancing its utility in various chemical applications.

Formula: C₆H₅NO₄

InChI: InChI=1/C6H5NO4/c8-5(9)3-1-2-4(7-3)6(10)11/h1-2,7H,(H,8,9)(H,10,11)

SMILES: c1cc(C(=O)O)[nH]c1C(=O)O

Synonyms:

• 937-27-9

1H-Pyrrole-2,5-dicarboxylic acid

CAS: 937-27-9

Formula: C₆H₅NO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 155.1082

Ref: IN-DA006EMK

1H-Pyrrole-2,5-dicarboxylic acid

CAS: 937-27-9

1H-Pyrrole-2,5-dicarboxylic acid

Purity: 97%

Molecular weight: 155.109g/mol

Ref: 54-OR74780

1H-Pyrrole-2,3-dicarboxylic acid

CAS: 937-27-9

1H-Pyrrole-2,3-dicarboxylic acid is a useful organic compound for research related to life sciences.

Formula: C₆H₅NO₄

Color and Shape: Solid

Molecular weight: 155.109

Ref: TM-T123904

1H-Pyrrole-2,5-dicarboxylic acid

CAS: 937-27-9

Formula: C₆H₅NO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 155.109

Ref: 10-F209167

1H-Pyrrole-2,5-dicarboxylic acid

CAS: 937-27-9

1H-Pyrrole-2,5-dicarboxylic acid is a biosynthetic precursor of the amide functional group. It is synthesized from the carboxylic acid functional group and ferrocene. It has been shown to be a putative precursor of pyrrole-2-carboxylic acid in the pyrrole system. 1H-Pyrrole-2,5-dicarboxylic acid reacts with carbon tetrachloride and diethyl iminodiacetate in refluxing chloroform to produce coelicolor. The reaction mechanism for this transformation is unknown, but it is hypothesized that it involves a radical mechanism.

Formula: C₆H₅NO₄

Purity: Min. 95%

Molecular weight: 155.11 g/mol

Ref: 3D-FP34730