CAS 937-28-0

trans-4-Hydroxy-4-methylcyclohexanecarboxylic acid

Description:

Trans-4-Hydroxy-4-methylcyclohexanecarboxylic acid, with the CAS number 937-28-0, is an organic compound characterized by its cyclohexane ring structure, which features a hydroxyl group (-OH) and a carboxylic acid group (-COOH) attached to the same carbon atom. This compound is a chiral molecule, existing in a specific stereoisomeric form due to the arrangement of its substituents. It is typically a white to off-white solid at room temperature and is soluble in polar solvents like water and alcohols, owing to the presence of the hydroxyl and carboxylic acid functional groups. The compound is of interest in various fields, including pharmaceuticals and organic synthesis, due to its potential applications in drug development and as an intermediate in chemical reactions. Its stability and reactivity can be influenced by the presence of functional groups, making it a versatile building block in organic chemistry. Additionally, the trans configuration contributes to its unique physical and chemical properties, differentiating it from its cis counterpart.

Formula: C₈H₁₄O₃

InChI: InChI=1/C8H14O3/c1-8(11)4-2-6(3-5-8)7(9)10/h6,11H,2-5H2,1H3,(H,9,10)/t6-,8-

InChI key: InChIKey=AZCRINBXSYWWOB-FKQCQYRANA-N

SMILES: C(O)(=O)[C@H]1CC[C@](C)(O)CC1

Synonyms:

• Cyclohexanecarboxylic acid, 4-hydroxy-4-methyl-, trans-
• trans-4-Hydroxy-4-methylcyclohexanecarboxylic acid
• trans-4-Carboxy-1-methylcyclohexanol