CymitQuimica logo

CAS 93700-41-5

:

3-Mercaptovaline ethyl ester

Description:
3-Mercaptovaline ethyl ester, with the CAS number 93700-41-5, is an organic compound characterized by the presence of a mercapto group (-SH) attached to a valine derivative. This compound typically exhibits properties associated with both amino acids and thiols, including the ability to form hydrogen bonds and participate in redox reactions due to the thiol group. It is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the ethyl ester group suggests that it may be soluble in organic solvents, while the mercapto group can impart unique reactivity, making it useful in various chemical syntheses and applications, such as in pharmaceuticals or as a building block in organic chemistry. Additionally, compounds with thiol functionalities are known for their potential antioxidant properties. However, specific handling precautions should be taken due to the reactivity of thiols and their potential for producing unpleasant odors.
Formula:C7H15NO2S
InChI:InChI=1S/C7H15NO2S/c1-4-10-6(9)5(8)7(2,3)11/h5,11H,4,8H2,1-3H3
InChI key:InChIKey=BIGXCCFRDGBPJN-UHFFFAOYSA-N
SMILES:C(C(C(C)(C)S)N)(OCC)=O
Synonyms:
  • Valine, 3-mercapto-, ethyl ester
  • DL-Valine, 3-mercapto-, ethyl ester
  • 3-Mercaptovaline ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.